cas: 355425-79-5 — see every product listed under this CAS number, including other names
Ethyl 4-hydrazinyl-3-nitrobenzoate 98% (CAS 355425-79-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A452229-1g |
| cas | 355425-79-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A452229 |
Ethyl 4-hydrazinyl-3-nitrobenzoate (CAS 355425-79-5) is a chemical compound with the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. IUPAC name: ethyl 4-hydrazinyl-3-nitrobenzoate. InChIKey: MAQFPKZXKHGKQY-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O4 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | ethyl 4-hydrazinyl-3-nitrobenzoate |
| InChIKey | MAQFPKZXKHGKQY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)