Products 1467999-93-4
CAS 1467999-93-4 is the registry number for 5-(3-Hydroxy-3-methyl-azetidine-1-carbonyl)-1h-pyrimidine-2,4-dione, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, on request.
5-(3-hydroxy-3-methylazetidine-1-carbonyl)-1H-pyrimidine-2,4-dione (CAS 1467999-93-4) is a chemical compound with the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. IUPAC name: 5-(3-hydroxy-3-methylazetidine-1-carbonyl)-1H-pyrimidine-2,4-dione. InChIKey: DHTKXDGLADQUSL-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O4 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | 5-(3-hydroxy-3-methylazetidine-1-carbonyl)-1H-pyrimidine-2,4-dione |
| InChIKey | DHTKXDGLADQUSL-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1)C(=O)C2=CNC(=O)NC2=O)O |
Computed by PubChem (NCBI)