Products 588679-98-5
CAS 588679-98-5 is the registry number for 2-(3-Methyl-4-nitrophenoxy)acetohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3-methyl-4-nitrophenoxy)acetohydrazide (CAS 588679-98-5) is a chemical compound with the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. IUPAC name: 2-(3-methyl-4-nitrophenoxy)acetohydrazide. InChIKey: YZHLJVYNDYJHDO-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O4 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | 2-(3-methyl-4-nitrophenoxy)acetohydrazide |
| InChIKey | YZHLJVYNDYJHDO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC(=O)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)