Products 59320-41-1

CAS 59320-41-1 is the registry number for 4-[(2-Aminoethyl)amino]-3-nitrobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(2-aminoethylamino)-3-nitrobenzoic acid (CAS 59320-41-1) is a chemical compound with the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. IUPAC name: 4-(2-aminoethylamino)-3-nitrobenzoic acid. InChIKey: UFDQDPCNAIIBSP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11N3O4
Molecular weight225.20 g/mol
IUPAC name4-(2-aminoethylamino)-3-nitrobenzoic acid
InChIKeyUFDQDPCNAIIBSP-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])NCCN

Computed by PubChem (NCBI)