CAS 1691084-34-0 is the registry number for 2-(4-Methyl-3-nitrophenoxy)acetohydrazide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
2-(4-methyl-3-nitrophenoxy)acetohydrazide (CAS 1691084-34-0) is a chemical compound with the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. IUPAC name: 2-(4-methyl-3-nitrophenoxy)acetohydrazide. InChIKey: WRDDEYLZHDMLNX-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O4 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | 2-(4-methyl-3-nitrophenoxy)acetohydrazide |
| InChIKey | WRDDEYLZHDMLNX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OCC(=O)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)