cas: 238749-53-6 — see every product listed under this CAS number, including other names
Ethyl 4H-pyrrolo[2,3-d]thiazole-5-carboxylate 97% (CAS 238749-53-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A431855-100mg |
| cas | 238749-53-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 2133.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A431855 |
Ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate (CAS 238749-53-6) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate. InChIKey: BXACPZGBYFAFIX-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate |
| InChIKey | BXACPZGBYFAFIX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)N=CS2 |
Computed by PubChem (NCBI)