cas: 2177257-76-8 — see every product listed under this CAS number, including other names
Ethyl 5,6-dihydro-4H-pyrrolo(3,4-d)oxazole-2-carboxylate hydrochloride, 95% (CAS 2177257-76-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1181377-1g |
| cas | 2177257-76-8 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 21650.65 Pln | |
| AmBeed | 250mg | 8702.26 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,3]oxazole-2-carboxylate;hydrochloride (CAS 2177257-76-8) is a chemical compound with the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. IUPAC name: ethyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,3]oxazole-2-carboxylate;hydrochloride. InChIKey: CZBCCXWVBZJMOP-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O3 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | ethyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,3]oxazole-2-carboxylate;hydrochloride |
| InChIKey | CZBCCXWVBZJMOP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(O1)CNC2.Cl |
Computed by PubChem (NCBI)