CAS 2453297-12-4 is the registry number for (R)–2–Amino–2–(3–nitrophenyl)ethan–1–ol hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(2R)-2-amino-2-(3-nitrophenyl)ethanol;hydrochloride (CAS 2453297-12-4) is a chemical compound with the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. IUPAC name: (2R)-2-amino-2-(3-nitrophenyl)ethanol;hydrochloride. InChIKey: FMKDBVMPPKFPSH-QRPNPIFTSA-N.
| Molecular formula | C8H11ClN2O3 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-nitrophenyl)ethanol;hydrochloride |
| InChIKey | FMKDBVMPPKFPSH-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])[C@H](CO)N.Cl |
Computed by PubChem (NCBI)