cas: 138742-18-4 — see every product listed under this CAS number, including other names
Ethyl 5-((tert-butoxycarbonyl)amino)isoxazole-3-carboxylate, 98+%, 98+% (CAS 138742-18-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1120G1-50mg |
| cas | 138742-18-4 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 1024.40 Pln | |
| Chemat | 100mg | 1701.20 Pln | |
| Chemat | 250mg | 2685.20 Pln | |
| Chemat | 1g | 6611.60 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2-oxazole-3-carboxylate (CAS 138742-18-4) is a chemical compound with the molecular formula C11H16N2O5 and a molecular weight of 256.25 g/mol. IUPAC name: ethyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2-oxazole-3-carboxylate. InChIKey: GFVJYQALSMLKHV-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O5 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | ethyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2-oxazole-3-carboxylate |
| InChIKey | GFVJYQALSMLKHV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)