CAS 56186-37-9 is the registry number for Acetamide, n-[1-[[(2,5-dioxo-1-pyrrolidinyl)oxy]carbonyl]-2-methylpropyl]-, (s)-, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(2,5-dioxopyrrolidin-1-yl) (2S)-2-acetamido-3-methylbutanoate (CAS 56186-37-9) is a chemical compound with the molecular formula C11H16N2O5 and a molecular weight of 256.25 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S)-2-acetamido-3-methylbutanoate. InChIKey: STTOHOQYWNJKIA-JTQLQIEISA-N.
| Molecular formula | C11H16N2O5 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-acetamido-3-methylbutanoate |
| InChIKey | STTOHOQYWNJKIA-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)C |
Computed by PubChem (NCBI)