Products 2007915-74-2

CAS 2007915-74-2 is the registry number for 1-(2-(tert-Butoxy)ethyl)-1h-imidazole-4,5-dicarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

1-[2-[(2-methylpropan-2-yl)oxy]ethyl]imidazole-4,5-dicarboxylic acid (CAS 2007915-74-2) is a chemical compound with the molecular formula C11H16N2O5 and a molecular weight of 256.25 g/mol. IUPAC name: 1-[2-[(2-methylpropan-2-yl)oxy]ethyl]imidazole-4,5-dicarboxylic acid. InChIKey: KJNVQMBOMKUHEC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16N2O5
Molecular weight256.25 g/mol
IUPAC name1-[2-[(2-methylpropan-2-yl)oxy]ethyl]imidazole-4,5-dicarboxylic acid
InChIKeyKJNVQMBOMKUHEC-UHFFFAOYSA-N
SMILESCC(C)(C)OCCN1C=NC(=C1C(=O)O)C(=O)O

Computed by PubChem (NCBI)