Products 958-74-7
CAS 958-74-7 appears in our catalog under these names: 3-Methylthymidine, 97%, N3-Methylthymidine, >95% (HPLC), N3–Methylthymidine, 3–Methylthymidine, N3-Methylthymidine. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 10mg, 1mg, 2mg, 5mg, 50mg.
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3,5-dimethylpyrimidine-2,4-dione (CAS 958-74-7) is a chemical compound with the molecular formula C11H16N2O5 and a molecular weight of 256.25 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3,5-dimethylpyrimidine-2,4-dione. InChIKey: JCVDICFLPGDHAT-DJLDLDEBSA-N.
| Molecular formula | C11H16N2O5 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3,5-dimethylpyrimidine-2,4-dione |
| InChIKey | JCVDICFLPGDHAT-DJLDLDEBSA-N |
| SMILES | CC1=CN(C(=O)N(C1=O)C)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)