CAS 14504-60-0 appears in our catalog under these names: 5'-O-Methylthymidine, 95%, 5'-O-Methylthymidine. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 100mg, 250mg, 2,5mg, 25mg, 5mg, 50mg, 500mg.
1-[(2R,4S,5R)-4-hydroxy-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 14504-60-0) is a chemical compound with the molecular formula C11H16N2O5 and a molecular weight of 256.25 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: KTCKNHCDUKONFQ-DJLDLDEBSA-N.
| Molecular formula | C11H16N2O5 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | KTCKNHCDUKONFQ-DJLDLDEBSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)COC)O |
Computed by PubChem (NCBI)