cas: 950259-82-2 — see every product listed under this CAS number, including other names
Ethyl 5-(4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylate, 97% (CAS 950259-82-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F214522-100MG |
| cas | 950259-82-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 409.25 Pln | |
| Fluorochem | 1g | 768.50 Pln | |
| Fluorochem | 5g | 2976.05 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 5-(4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylate (CAS 950259-82-2) is a chemical compound with the molecular formula C11H9FN2O3 and a molecular weight of 236.20 g/mol. IUPAC name: ethyl 5-(4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylate. InChIKey: YVDWIXOLWWSICJ-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O3 |
|---|---|
| Molecular weight | 236.20 g/mol |
| IUPAC name | ethyl 5-(4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | YVDWIXOLWWSICJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN=C(O1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)