CAS 500025-07-0 is the registry number for 3-[3-(4-Fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS 500025-07-0) is a chemical compound with the molecular formula C11H9FN2O3 and a molecular weight of 236.20 g/mol. IUPAC name: 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid. InChIKey: BUMRHSFCLPSTJE-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O3 |
|---|---|
| Molecular weight | 236.20 g/mol |
| IUPAC name | 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid |
| InChIKey | BUMRHSFCLPSTJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CCC(=O)O)F |
Computed by PubChem (NCBI)