Products 485798-67-2

CAS 485798-67-2 is the registry number for 3-(3-Fluoro-4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3-fluoro-4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid (CAS 485798-67-2) is a chemical compound with the molecular formula C11H9FN2O3 and a molecular weight of 236.20 g/mol. IUPAC name: 3-(3-fluoro-4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: ZJQHIEFMHVCCBN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9FN2O3
Molecular weight236.20 g/mol
IUPAC name3-(3-fluoro-4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid
InChIKeyZJQHIEFMHVCCBN-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C2=NNC(=C2)C(=O)O)F

Computed by PubChem (NCBI)