Products 2024389-76-0
CAS 2024389-76-0 appears in our catalog under these names: 1-(3-Fluoro-5-methoxyphenyl)-1H-pyrazole-3-carboxylic acid, 95%, 1-(3-Fluoro-5-methoxyphenyl)-1H-pyrazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(3-fluoro-5-methoxyphenyl)pyrazole-3-carboxylic acid (CAS 2024389-76-0) is a chemical compound with the molecular formula C11H9FN2O3 and a molecular weight of 236.20 g/mol. IUPAC name: 1-(3-fluoro-5-methoxyphenyl)pyrazole-3-carboxylic acid. InChIKey: JPMUPWLEVIIHIP-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O3 |
|---|---|
| Molecular weight | 236.20 g/mol |
| IUPAC name | 1-(3-fluoro-5-methoxyphenyl)pyrazole-3-carboxylic acid |
| InChIKey | JPMUPWLEVIIHIP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)N2C=CC(=N2)C(=O)O)F |
Computed by PubChem (NCBI)