CAS 1239726-11-4 appears in our catalog under these names: 1-(2-Fluorophenyl)-5-methoxy-1h-pyrazole-3-carboxylic acid, 95%, 1–(2–Fluorophenyl)–5–methoxy–1H–pyrazole–3–carboxylic acid, 1-(2-Fluorophenyl)-5-methoxy-1H-pyrazole-3-carboxylic acid 97%, 1-(2-Fluorophenyl)-5-methoxy-1H-pyrazole-3-carboxylic acid, 97%, 97%, 1-(2-Fluorophenyl)-5-methoxy-1H-pyrazole-3-carboxylic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
1-(2-fluorophenyl)-5-methoxypyrazole-3-carboxylic acid (CAS 1239726-11-4) is a chemical compound with the molecular formula C11H9FN2O3 and a molecular weight of 236.20 g/mol. IUPAC name: 1-(2-fluorophenyl)-5-methoxypyrazole-3-carboxylic acid. InChIKey: APAWIBFJIYLTND-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O3 |
|---|---|
| Molecular weight | 236.20 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-5-methoxypyrazole-3-carboxylic acid |
| InChIKey | APAWIBFJIYLTND-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NN1C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)