cas: 163521-20-8 — see every product listed under this CAS number, including other names
Ethyl 5-(piperazin-1-yl)benzofuran-2-carboxylate, 97%, 97% (CAS 163521-20-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112U7X-250mg |
| cas | 163521-20-8 |
| size | 250mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 539.60 Pln | |
| Chemat | 10g | 851.60 Pln | |
| Chemat | 25g | 1643.60 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 100g | 4226.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-piperazin-1-yl-1-benzofuran-2-carboxylate (CAS 163521-20-8) is a chemical compound with the molecular formula C15H18N2O3 and a molecular weight of 274.31 g/mol. IUPAC name: ethyl 5-piperazin-1-yl-1-benzofuran-2-carboxylate. InChIKey: ZKLDXJIVWKPASZ-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O3 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | ethyl 5-piperazin-1-yl-1-benzofuran-2-carboxylate |
| InChIKey | ZKLDXJIVWKPASZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(O1)C=CC(=C2)N3CCNCC3 |
Computed by PubChem (NCBI)