cas: 163521-20-8 — see every product listed under this CAS number, including other names
Ethyl 5-(piperazin-1-yl)benzofuran-2-carboxylate, 98% (CAS 163521-20-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A264664-250mg |
| cas | 163521-20-8 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 421.54 Pln | |
| AmBeed | 1g | 493.15 Pln | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 820.56 Pln | |
| Fluorochem | 10g | 1158.98 Pln | |
| Fluorochem | 25g | 2189.87 Pln | |
| Fluorochem | 100g | 5579.30 Pln | |
| Fluorochem | 500g | 17746.89 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 5-piperazin-1-yl-1-benzofuran-2-carboxylate (CAS 163521-20-8) is a chemical compound with the molecular formula C15H18N2O3 and a molecular weight of 274.31 g/mol. IUPAC name: ethyl 5-piperazin-1-yl-1-benzofuran-2-carboxylate. InChIKey: ZKLDXJIVWKPASZ-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O3 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | ethyl 5-piperazin-1-yl-1-benzofuran-2-carboxylate |
| InChIKey | ZKLDXJIVWKPASZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(O1)C=CC(=C2)N3CCNCC3 |
Computed by PubChem (NCBI)