cas: 163521-20-8 — see every product listed under this CAS number, including other names
Ethyl 5-piperazin-1-ylbenzofuran-2-carboxylate, 99.88% (CAS 163521-20-8) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 250 mg, 1 g, 500 mg, 5 g, 50 g, 100 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-77058-10 g |
| cas | 163521-20-8 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 1369.24 Pln | |
| MedChemExpress | 250 mg | 240.74 Pln | |
| MedChemExpress | 1 g | 431.15 Pln | |
| MedChemExpress | 500 mg | 310.40 Pln | |
| MedChemExpress | 5 g | 886.26 Pln | |
| MedChemExpress | 50 g | 4099.91 Pln | |
| MedChemExpress | 100 g | 6477.64 Pln | |
| MedChemExpress | 25 g | 2637.05 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.88% |
Ethyl 5-piperazin-1-yl-1-benzofuran-2-carboxylate (CAS 163521-20-8) is a chemical compound with the molecular formula C15H18N2O3 and a molecular weight of 274.31 g/mol. IUPAC name: ethyl 5-piperazin-1-yl-1-benzofuran-2-carboxylate. InChIKey: ZKLDXJIVWKPASZ-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O3 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | ethyl 5-piperazin-1-yl-1-benzofuran-2-carboxylate |
| InChIKey | ZKLDXJIVWKPASZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(O1)C=CC(=C2)N3CCNCC3 |
Computed by PubChem (NCBI)