Ethyl 5-aminobenzofuran-2-carboxylate hydrochloride, 98%, 98%
cas: 183288-42-8 — see every product listed under this CAS number, including other names
Ethyl 5-aminobenzofuran-2-carboxylate hydrochloride, 98%, 98% (CAS 183288-42-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1138GI-100mg |
| cas | 183288-42-8 |
| size | 100mg |
| availability | 25g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 918.80 Pln | |
| Chemat | 10g | 1490.00 Pln | |
| Chemat | 25g | 2920.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-amino-1-benzofuran-2-carboxylate;hydrochloride (CAS 183288-42-8) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: ethyl 5-amino-1-benzofuran-2-carboxylate;hydrochloride. InChIKey: XGGIUALENXNONX-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | ethyl 5-amino-1-benzofuran-2-carboxylate;hydrochloride |
| InChIKey | XGGIUALENXNONX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(O1)C=CC(=C2)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
5-Aminobenzofuran-2-carboxylicacidethylester hydrochloride, Ethyl 5-aminobenzofuran-2-carboxylate hydrochloride, ethyl 5-amino-1-benzofuran-2-carboxylate hydrochloride, Ethyl 5-aMinobenzofuran-2-carboxylate (hydrochloride), ethyl 5-amino-1-benzofuran-2-carboxylate;hydrochloride, Ethyl 5-amino-1-benzofuran-2-carboxylate HCl, Ethyl5-aminobenzofuran-2-carboxylatehydrochloride, ethyl 5-aminobenzofuran-2-carboxylate;hydrochloride