cas: 1255098-82-8 — see every product listed under this CAS number, including other names
Ethyl 5-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate 98% (CAS 1255098-82-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A332782-100mg |
| cas | 1255098-82-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 609.56 Pln | |
| Ambeed | 5g | 1939.00 Pln | |
| Ambeed | 25g | 8830.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A332782 |
Ethyl 5-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate (CAS 1255098-82-8) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl 5-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate. InChIKey: BDJZZKVOBJHYTD-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl 5-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate |
| InChIKey | BDJZZKVOBJHYTD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=N2)Br |
Computed by PubChem (NCBI)