cas: 950741-84-1 — see every product listed under this CAS number, including other names
Ethyl 5-bromo-2-(bromomethyl)benzoate 97% (CAS 950741-84-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A205197-250mg |
| cas | 950741-84-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1010.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A205197 |
Ethyl 5-bromo-2-(bromomethyl)benzoate (CAS 950741-84-1) is a chemical compound with the molecular formula C10H10Br2O2 and a molecular weight of 321.99 g/mol. IUPAC name: ethyl 5-bromo-2-(bromomethyl)benzoate. InChIKey: PHSGNAVTTZJUOE-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O2 |
|---|---|
| Molecular weight | 321.99 g/mol |
| IUPAC name | ethyl 5-bromo-2-(bromomethyl)benzoate |
| InChIKey | PHSGNAVTTZJUOE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)Br)CBr |
Computed by PubChem (NCBI)