cas: 359629-91-7 — see every product listed under this CAS number, including other names
Ethyl 5-bromo-2-methylbenzoate, 98%, 98% (CAS 359629-91-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CJ3A-100mg |
| cas | 359629-91-7 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 208.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-bromo-2-methylbenzoate (CAS 359629-91-7) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: ethyl 5-bromo-2-methylbenzoate. InChIKey: NHMJLUHCYZHKMO-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | ethyl 5-bromo-2-methylbenzoate |
| InChIKey | NHMJLUHCYZHKMO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)Br)C |
Computed by PubChem (NCBI)