cas: 359629-91-7 — see every product listed under this CAS number, including other names
Ethyl 5-bromo-2-methylbenzoate, 98% (CAS 359629-91-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F328126-250MG |
| cas | 359629-91-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 664.37 Pln | |
| Fluorochem | 10g | 1226.67 Pln | |
| Fluorochem | 25g | 2372.10 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 5-bromo-2-methylbenzoate (CAS 359629-91-7) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: ethyl 5-bromo-2-methylbenzoate. InChIKey: NHMJLUHCYZHKMO-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | ethyl 5-bromo-2-methylbenzoate |
| InChIKey | NHMJLUHCYZHKMO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)Br)C |
Computed by PubChem (NCBI)