cas: 914347-21-0 — see every product listed under this CAS number, including other names
Ethyl 5-bromo-2-phenylthiazole-4-carboxylate 97% (CAS 914347-21-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A270290-250mg |
| cas | 914347-21-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1110.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A270290 |
Ethyl 5-bromo-2-phenyl-1,3-thiazole-4-carboxylate (CAS 914347-21-0) is a chemical compound with the molecular formula C12H10BrNO2S and a molecular weight of 312.18 g/mol. IUPAC name: ethyl 5-bromo-2-phenyl-1,3-thiazole-4-carboxylate. InChIKey: ONAJVAODOMRERW-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2S |
|---|---|
| Molecular weight | 312.18 g/mol |
| IUPAC name | ethyl 5-bromo-2-phenyl-1,3-thiazole-4-carboxylate |
| InChIKey | ONAJVAODOMRERW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=N1)C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)