cas: 1363381-49-0 — see every product listed under this CAS number, including other names
Ethyl 5-bromopyrazolo[1,5-a]pyridine-2-carboxylate 97% (CAS 1363381-49-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A812860-100mg |
| cas | 1363381-49-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 826.50 Pln | |
| Ambeed | 250mg | 1299.31 Pln | |
| Ambeed | 1g | 3307.38 Pln | |
| Ambeed | 5g | 9926.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A812860 |
Ethyl 5-bromopyrazolo[1,5-a]pyridine-2-carboxylate (CAS 1363381-49-0) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl 5-bromopyrazolo[1,5-a]pyridine-2-carboxylate. InChIKey: XGUHTZZXYKJZFC-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl 5-bromopyrazolo[1,5-a]pyridine-2-carboxylate |
| InChIKey | XGUHTZZXYKJZFC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN2C=CC(=CC2=C1)Br |
Computed by PubChem (NCBI)