cas: 846541-71-7 — see every product listed under this CAS number, including other names
Ethyl 5-chloro-4,6-dihydroxynicotinate 95% (CAS 846541-71-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A528840-50mg |
| cas | 846541-71-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 642.94 Pln | |
| Ambeed | 100mg | 1032.31 Pln | |
| Ambeed | 250mg | 1994.62 Pln | |
| Ambeed | 1g | 5832.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A528840 |
Ethyl 5-chloro-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate (CAS 846541-71-7) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: ethyl 5-chloro-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate. InChIKey: SEFFUTOCCLZPNV-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | ethyl 5-chloro-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate |
| InChIKey | SEFFUTOCCLZPNV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC(=O)C(=C1O)Cl |
Computed by PubChem (NCBI)