Products 1305324-74-6

CAS 1305324-74-6 is the registry number for 5-Chloro-2,3-dimethoxyisonicotinic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-chloro-2,3-dimethoxypyridine-4-carboxylic acid (CAS 1305324-74-6) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: 5-chloro-2,3-dimethoxypyridine-4-carboxylic acid. InChIKey: UGNGWVBHFYKDCD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClNO4
Molecular weight217.60 g/mol
IUPAC name5-chloro-2,3-dimethoxypyridine-4-carboxylic acid
InChIKeyUGNGWVBHFYKDCD-UHFFFAOYSA-N
SMILESCOC1=C(C(=CN=C1OC)Cl)C(=O)O

Computed by PubChem (NCBI)