CAS 1305324-74-6 is the registry number for 5-Chloro-2,3-dimethoxyisonicotinic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
5-chloro-2,3-dimethoxypyridine-4-carboxylic acid (CAS 1305324-74-6) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: 5-chloro-2,3-dimethoxypyridine-4-carboxylic acid. InChIKey: UGNGWVBHFYKDCD-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | 5-chloro-2,3-dimethoxypyridine-4-carboxylic acid |
| InChIKey | UGNGWVBHFYKDCD-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CN=C1OC)Cl)C(=O)O |
Computed by PubChem (NCBI)