CAS 78265-48-2 is the registry number for 1-chloro-2,3-dimethoxy-5-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-chloro-2,3-dimethoxy-5-nitrobenzene (CAS 78265-48-2) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: 1-chloro-2,3-dimethoxy-5-nitrobenzene. InChIKey: MXBYAURLPFCFCS-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | 1-chloro-2,3-dimethoxy-5-nitrobenzene |
| InChIKey | MXBYAURLPFCFCS-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)[N+](=O)[O-])Cl)OC |
Computed by PubChem (NCBI)