CAS 1393442-37-9 is the registry number for 2-Chloro-3,4-dimethoxy-1-nitrobenzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-chloro-1,2-dimethoxy-4-nitrobenzene (CAS 1393442-37-9) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: 3-chloro-1,2-dimethoxy-4-nitrobenzene. InChIKey: BYVZLDRFSQXIEM-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | 3-chloro-1,2-dimethoxy-4-nitrobenzene |
| InChIKey | BYVZLDRFSQXIEM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)[N+](=O)[O-])Cl)OC |
Computed by PubChem (NCBI)