CAS 846541-71-7 appears in our catalog under these names: Ethyl 5-chloro-4,6-dihydroxynicotinate, 95%, Ethyl 5-chloro-4,6-dihydroxynicotinate 95%, Ethyl 5-chloro-4,6-dihydroxynicotinate, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 50mg.
Ethyl 5-chloro-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate (CAS 846541-71-7) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: ethyl 5-chloro-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate. InChIKey: SEFFUTOCCLZPNV-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | ethyl 5-chloro-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate |
| InChIKey | SEFFUTOCCLZPNV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC(=O)C(=C1O)Cl |
Computed by PubChem (NCBI)