cas: 24985-85-1 — see every product listed under this CAS number, including other names
Ethyl 5-hydroxyindole-2-carboxylate 97% (CAS 24985-85-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A161982-100g |
| cas | 24985-85-1 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 15289.00 Pln | |
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1032.31 Pln | |
| Ambeed | 10g | 1994.62 Pln | |
| Ambeed | 25g | 4825.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A161982 |
Ethyl 5-hydroxy-1H-indole-2-carboxylate (CAS 24985-85-1) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: ethyl 5-hydroxy-1H-indole-2-carboxylate. InChIKey: WANAXLMRGYGCPC-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | ethyl 5-hydroxy-1H-indole-2-carboxylate |
| InChIKey | WANAXLMRGYGCPC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)O |
Computed by PubChem (NCBI)