cas: 24985-85-1 — see every product listed under this CAS number, including other names
Ethyl 5-hydroxyindole-2-carboxylate, 97%, 97% (CAS 24985-85-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113Q4A-100mg |
| cas | 24985-85-1 |
| size | 100mg |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 10g | 1874.00 Pln | |
| Chemat | 25g | 4446.80 Pln | |
| Chemat | 100g | 11742.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-hydroxy-1H-indole-2-carboxylate (CAS 24985-85-1) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: ethyl 5-hydroxy-1H-indole-2-carboxylate. InChIKey: WANAXLMRGYGCPC-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | ethyl 5-hydroxy-1H-indole-2-carboxylate |
| InChIKey | WANAXLMRGYGCPC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)O |
Computed by PubChem (NCBI)