cas: 2091009-80-0 — see every product listed under this CAS number, including other names
Ethyl 6-bromo-3-chloro-5-methylpyrazine-2-carboxylate 97% (CAS 2091009-80-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1181830-100mg |
| cas | 2091009-80-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 654.06 Pln | |
| Ambeed | 1g | 1705.38 Pln | |
| Ambeed | 5g | 5493.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1181830 |
Ethyl 6-bromo-3-chloro-5-methylpyrazine-2-carboxylate (CAS 2091009-80-0) is a chemical compound with the molecular formula C8H8BrClN2O2 and a molecular weight of 279.52 g/mol. IUPAC name: ethyl 6-bromo-3-chloro-5-methylpyrazine-2-carboxylate. InChIKey: GHRIDABVKDEQNS-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2O2 |
|---|---|
| Molecular weight | 279.52 g/mol |
| IUPAC name | ethyl 6-bromo-3-chloro-5-methylpyrazine-2-carboxylate |
| InChIKey | GHRIDABVKDEQNS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=C(N=C1Cl)C)Br |
Computed by PubChem (NCBI)