cas: 2091009-80-0 — see every product listed under this CAS number, including other names
Ethyl 6-bromo-3-chloro-5-methylpyrazine-2-carboxylate, 98% (CAS 2091009-80-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F619788-100MG |
| cas | 2091009-80-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 346.77 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 500mg | 1034.03 Pln | |
| Fluorochem | 1g | 1695.25 Pln | |
| Fluorochem | 5g | 5511.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 6-bromo-3-chloro-5-methylpyrazine-2-carboxylate (CAS 2091009-80-0) is a chemical compound with the molecular formula C8H8BrClN2O2 and a molecular weight of 279.52 g/mol. IUPAC name: ethyl 6-bromo-3-chloro-5-methylpyrazine-2-carboxylate. InChIKey: GHRIDABVKDEQNS-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2O2 |
|---|---|
| Molecular weight | 279.52 g/mol |
| IUPAC name | ethyl 6-bromo-3-chloro-5-methylpyrazine-2-carboxylate |
| InChIKey | GHRIDABVKDEQNS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=C(N=C1Cl)C)Br |
Computed by PubChem (NCBI)