cas: 1805648-67-2 — see every product listed under this CAS number, including other names
Ethyl 6-chloro-3-nitropicolinate, 97% (CAS 1805648-67-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F543860-250MG |
| cas | 1805648-67-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 575.86 Pln | |
| Fluorochem | 5g | 2564.74 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 6-chloro-3-nitropyridine-2-carboxylate (CAS 1805648-67-2) is a chemical compound with the molecular formula C8H7ClN2O4 and a molecular weight of 230.60 g/mol. IUPAC name: ethyl 6-chloro-3-nitropyridine-2-carboxylate. InChIKey: MUYYRHKUFWKCBU-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O4 |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | ethyl 6-chloro-3-nitropyridine-2-carboxylate |
| InChIKey | MUYYRHKUFWKCBU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)