Products 156016-33-0
CAS 156016-33-0 is the registry number for N-(5-Chloro-2-hydroxy-3-nitrophenyl)acetamide, >95% (HPLC). Offered by: TRC. Available pack sizes: 1g, 2g, 5g.
N-(5-chloro-2-hydroxy-3-nitrophenyl)acetamide (CAS 156016-33-0) is a chemical compound with the molecular formula C8H7ClN2O4 and a molecular weight of 230.60 g/mol. IUPAC name: N-(5-chloro-2-hydroxy-3-nitrophenyl)acetamide. InChIKey: RSCLKRDPCPYTGC-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O4 |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | N-(5-chloro-2-hydroxy-3-nitrophenyl)acetamide |
| InChIKey | RSCLKRDPCPYTGC-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C(=CC(=C1)Cl)[N+](=O)[O-])O |
Computed by PubChem (NCBI)