Products 642068-72-2
CAS 642068-72-2 is the registry number for Methyl 3-amino-4-chloro-5-nitrobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-amino-4-chloro-5-nitrobenzoate (CAS 642068-72-2) is a chemical compound with the molecular formula C8H7ClN2O4 and a molecular weight of 230.60 g/mol. IUPAC name: methyl 3-amino-4-chloro-5-nitrobenzoate. InChIKey: DNGLZBFIGKDACR-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O4 |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | methyl 3-amino-4-chloro-5-nitrobenzoate |
| InChIKey | DNGLZBFIGKDACR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)N |
Computed by PubChem (NCBI)