cas: 38923-08-9 — see every product listed under this CAS number, including other names
Ethyl 6-nitroimidazo[1,2-a]pyridine-2-carboxylate, 97%, 97% (CAS 38923-08-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BZT1-250mg |
| cas | 38923-08-9 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 251.60 Pln | |
| Chemat | 25g | 1043.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 6-nitroimidazo[1,2-a]pyridine-2-carboxylate (CAS 38923-08-9) is a chemical compound with the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. IUPAC name: ethyl 6-nitroimidazo[1,2-a]pyridine-2-carboxylate. InChIKey: XOXFLWMGZPJKAF-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O4 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | ethyl 6-nitroimidazo[1,2-a]pyridine-2-carboxylate |
| InChIKey | XOXFLWMGZPJKAF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C=C(C=CC2=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)