Products 2488794-84-7
CAS 2488794-84-7 is the registry number for 1-(2-Chloro-3-(1,1-difluoro-2-hydroxyethyl)phenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-chloro-3-(1,1-difluoro-2-hydroxyethyl)phenyl]ethanone (CAS 2488794-84-7) is a chemical compound with the molecular formula C10H9ClF2O2 and a molecular weight of 234.62 g/mol. IUPAC name: 1-[2-chloro-3-(1,1-difluoro-2-hydroxyethyl)phenyl]ethanone. InChIKey: YNYZUKOIPRAVCJ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2O2 |
|---|---|
| Molecular weight | 234.62 g/mol |
| IUPAC name | 1-[2-chloro-3-(1,1-difluoro-2-hydroxyethyl)phenyl]ethanone |
| InChIKey | YNYZUKOIPRAVCJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC=C1)C(CO)(F)F)Cl |
Computed by PubChem (NCBI)