CAS 1248075-48-0 appears in our catalog under these names: Benzeneacetic acid, 2-chloro-alpha,alpha-difluoro-, ethyl ester, 95%, ethyl 2–(2–chlorophenyl)–2，2–difluoroacetate, Ethyl 2-(2-Chlorophenyl)-2,2-difluoroacetate, 98%, 98%, Ethyl 2-(2-chlorophenyl)-2,2-difluoroacetate, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg.
Ethyl 2-(2-chlorophenyl)-2,2-difluoroacetate (CAS 1248075-48-0) is a chemical compound with the molecular formula C10H9ClF2O2 and a molecular weight of 234.62 g/mol. IUPAC name: ethyl 2-(2-chlorophenyl)-2,2-difluoroacetate. InChIKey: RTPZPIXDNPGMRW-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2O2 |
|---|---|
| Molecular weight | 234.62 g/mol |
| IUPAC name | ethyl 2-(2-chlorophenyl)-2,2-difluoroacetate |
| InChIKey | RTPZPIXDNPGMRW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC=C1Cl)(F)F |
Computed by PubChem (NCBI)