Products 1824049-73-1
CAS 1824049-73-1 is the registry number for 2-chloro-2,2-difluoro-1-(4-methoxy-3-methylphenyl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-chloro-2,2-difluoro-1-(4-methoxy-3-methylphenyl)ethanone (CAS 1824049-73-1) is a chemical compound with the molecular formula C10H9ClF2O2 and a molecular weight of 234.62 g/mol. IUPAC name: 2-chloro-2,2-difluoro-1-(4-methoxy-3-methylphenyl)ethanone. InChIKey: HKUCCJQFGFMRNR-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2O2 |
|---|---|
| Molecular weight | 234.62 g/mol |
| IUPAC name | 2-chloro-2,2-difluoro-1-(4-methoxy-3-methylphenyl)ethanone |
| InChIKey | HKUCCJQFGFMRNR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)C(F)(F)Cl)OC |
Computed by PubChem (NCBI)