cas: 1092977-61-1 — see every product listed under this CAS number, including other names
Evenamide, 96.45% (CAS 1092977-61-1) is a chemical reagent available from Chemat. Available pack sizes: 50 mg, 10 mg, 5 mg, 10mM/1mL, 100 mg, 25 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-17612-50 mg |
| cas | 1092977-61-1 |
| size | 50 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 mg | 2567.39 Pln | |
| MedChemExpress | 10 mg | 886.26 Pln | |
| MedChemExpress | 5 mg | 598.33 Pln | |
| MedChemExpress | 10mM/1mL | 649.42 Pln | |
| MedChemExpress | 100 mg | 4053.47 Pln | |
| MedChemExpress | 25 mg | 1657.16 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 96.45% |
2-[2-(3-butoxyphenyl)ethylamino]-N,N-dimethylacetamide (CAS 1092977-61-1) is a chemical compound with the molecular formula C16H26N2O2 and a molecular weight of 278.39 g/mol. IUPAC name: 2-[2-(3-butoxyphenyl)ethylamino]-N,N-dimethylacetamide. InChIKey: GRHBODILPPXVKN-UHFFFAOYSA-N.
| Molecular formula | C16H26N2O2 |
|---|---|
| Molecular weight | 278.39 g/mol |
| IUPAC name | 2-[2-(3-butoxyphenyl)ethylamino]-N,N-dimethylacetamide |
| InChIKey | GRHBODILPPXVKN-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=CC(=C1)CCNCC(=O)N(C)C |
Computed by PubChem (NCBI)