CAS 1092977-61-1 appears in our catalog under these names: 2-((3-Butoxyphenethyl)amino)-n,n-dimethylacetamide, 95%, Evenamide/ 99.15% (existing batch purity), Evenamide, 2-[[2-(3-Butoxyphenyl)ethyl]amino]-N,N-dimethylacetamide, 95%, 95%, Evenamide, 96.45%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso).
2-[2-(3-butoxyphenyl)ethylamino]-N,N-dimethylacetamide (CAS 1092977-61-1) is a chemical compound with the molecular formula C16H26N2O2 and a molecular weight of 278.39 g/mol. IUPAC name: 2-[2-(3-butoxyphenyl)ethylamino]-N,N-dimethylacetamide. InChIKey: GRHBODILPPXVKN-UHFFFAOYSA-N.
| Molecular formula | C16H26N2O2 |
|---|---|
| Molecular weight | 278.39 g/mol |
| IUPAC name | 2-[2-(3-butoxyphenyl)ethylamino]-N,N-dimethylacetamide |
| InChIKey | GRHBODILPPXVKN-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=CC(=C1)CCNCC(=O)N(C)C |
Computed by PubChem (NCBI)