cas: 1092977-61-1 — see every product listed under this CAS number, including other names
Evenamide (CAS 1092977-61-1) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 100mg. Offered by: GLPBio, Biosynth.
| brand | GLPBio |
|---|---|
| catalog number | GC38389-10 |
| cas | 1092977-61-1 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 1088.49 Pln | |
| GLPBio | 25mg | 1762.48 Pln | |
| GLPBio | 5mg | 835.75 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 877.87 Pln | |
| GLPBio | 50mg | 2562.85 Pln | |
| Biosynth | 100mg | price on request |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[2-(3-butoxyphenyl)ethylamino]-N,N-dimethylacetamide (CAS 1092977-61-1) is a chemical compound with the molecular formula C16H26N2O2 and a molecular weight of 278.39 g/mol. IUPAC name: 2-[2-(3-butoxyphenyl)ethylamino]-N,N-dimethylacetamide. InChIKey: GRHBODILPPXVKN-UHFFFAOYSA-N.
| Molecular formula | C16H26N2O2 |
|---|---|
| Molecular weight | 278.39 g/mol |
| IUPAC name | 2-[2-(3-butoxyphenyl)ethylamino]-N,N-dimethylacetamide |
| InChIKey | GRHBODILPPXVKN-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=CC(=C1)CCNCC(=O)N(C)C |
Computed by PubChem (NCBI)