Products 1359963-68-0
CAS 1359963-68-0 appears in our catalog under these names: FEMA 4774/ 99.97% (existing batch purity), FEMA 4774, FEMA 4774, FEMA 4774 99%, FEMA 4774, ≥98%, ≥98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 100 mg.
4-amino-5-[2,2-dimethyl-3-oxo-3-(propan-2-ylamino)propoxy]-2-methylquinoline-3-carboxylic acid (CAS 1359963-68-0) is a chemical compound with the molecular formula C19H25N3O4 and a molecular weight of 359.4 g/mol. IUPAC name: 4-amino-5-[2,2-dimethyl-3-oxo-3-(propan-2-ylamino)propoxy]-2-methylquinoline-3-carboxylic acid. InChIKey: RHXLOOCFQPJWBW-UHFFFAOYSA-N.
| Molecular formula | C19H25N3O4 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 4-amino-5-[2,2-dimethyl-3-oxo-3-(propan-2-ylamino)propoxy]-2-methylquinoline-3-carboxylic acid |
| InChIKey | RHXLOOCFQPJWBW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C2C(=N1)C=CC=C2OCC(C)(C)C(=O)NC(C)C)N)C(=O)O |
Computed by PubChem (NCBI)