Products 646068-80-6
CAS 646068-80-6 appears in our catalog under these names: Fmoc-β-HomoCys(Trt)-OH, 98%, 98%, Fmoc-β-HomoCys(Trt)-OH, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 5g, 100mg, 250mg, 1g.
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid (CAS 646068-80-6) is a chemical compound with the molecular formula C38H33NO4S and a molecular weight of 599.7 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid. InChIKey: IFMIEVGWSYSZOU-SSEXGKCCSA-N.
| Molecular formula | C38H33NO4S |
|---|---|
| Molecular weight | 599.7 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid |
| InChIKey | IFMIEVGWSYSZOU-SSEXGKCCSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SC[C@@H](CC(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)