CAS 725728-37-0 is the registry number for Fmoc-alpha-Me-D-Cys(Trt)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 250mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-tritylsulfanylpropanoic acid (CAS 725728-37-0) is a chemical compound with the molecular formula C38H33NO4S and a molecular weight of 599.7 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-tritylsulfanylpropanoic acid. InChIKey: AWLPKAIRGNZKIN-DIPNUNPCSA-N.
| Molecular formula | C38H33NO4S |
|---|---|
| Molecular weight | 599.7 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-tritylsulfanylpropanoic acid |
| InChIKey | AWLPKAIRGNZKIN-DIPNUNPCSA-N |
| SMILES | C[C@@](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)(C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)